About 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide
2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide (PubChem CID 130033757) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide |
| PubChem CID | 130033757 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide |
| SMILES | [H]/N=C(/C(O)c1cccc(O)c1)N(C)C |
| InChI | InChI=1S/C10H14N2O2/c1-12(2)10(11)9(14)7-4-3-5-8(13)6-7/h3-6,9,11,13-14H,1-2H3/b11-10- |
| InChIKey | NOTYLIOFWMOMFP-KHPPLWFESA-N |
| XLogP | 0.96 |
| TPSA | 67.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide?
The IUPAC name of 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide (CID 130033757) is 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide.
What is the SMILES notation for 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide?
The canonical SMILES for 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide is [H]/N=C(/C(O)c1cccc(O)c1)N(C)C.
What is the InChIKey of 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide?
The InChIKey is NOTYLIOFWMOMFP-KHPPLWFESA-N. The full InChI is InChI=1S/C10H14N2O2/c1-12(2)10(11)9(14)7-4-3-5-8(13)6-7/h3-6,9,11,13-14H,1-2H3/b11-10-.
What are the key properties of 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide?
2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide has a molecular weight of 194.23 g/mol, XLogP of 0.96, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(3-hydroxyphenyl)-N,N-dimethylethanimidamide is sourced from PubChem (CID 130033757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).