About 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol
5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol (PubChem CID 130035071) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol.
Molecular Properties
| Compound Name | 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol |
| PubChem CID | 130035071 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol |
| SMILES | COc1c(C)cc2c(c1O)CN(C)C2 |
| InChI | InChI=1S/C11H15NO2/c1-7-4-8-5-12(2)6-9(8)10(13)11(7)14-3/h4,13H,5-6H2,1-3H3 |
| InChIKey | GKDPWPNOFKBYAG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol?
The IUPAC name of 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol (CID 130035071) is 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol.
What is the SMILES notation for 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol?
The canonical SMILES for 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol is COc1c(C)cc2c(c1O)CN(C)C2.
What is the InChIKey of 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol?
The InChIKey is GKDPWPNOFKBYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-7-4-8-5-12(2)6-9(8)10(13)11(7)14-3/h4,13H,5-6H2,1-3H3.
What are the key properties of 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol?
5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol has a molecular weight of 193.25 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,6-dimethyl-1,3-dihydroisoindol-4-ol is sourced from PubChem (CID 130035071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).