C10H15NO2 — CID 130035986
2-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-5-yl)acetaldehyde (PubChem CID 130035986) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-5-yl)acetaldehyde.
| Compound Name | 2-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-5-yl)acetaldehyde |
|---|---|
| PubChem CID | 130035986 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-5-yl)acetaldehyde |
| SMILES | O=CCC1CCCC2CCC(=O)N12 |
| InChI | InChI=1S/C10H15NO2/c12-7-6-9-3-1-2-8-4-5-10(13)11(8)9/h7-9H,1-6H2 |
| InChIKey | QATXCGKJKWSPFK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|