dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate

C13H18O4 — CID 13003701

IUPACdimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
SMILESCOC(=O)C1(C)C2C=CC(C2)C1(C)C(=O)OC
InChIInChI=1S/C13H18O4/c1-12(10(14)16-3)8-5-6-9(7-8)13(12,2)11(15)17-4/h5-6,8-9H,7H2,1-4H3
InChIKeyYADDCRBBADSPJJ-UHFFFAOYSA-N
MW238.28 g/mol
LogP1.55
Rot. Bonds2

About dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate

dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 13003701) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.

Molecular Properties

Compound Namedimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
PubChem CID13003701
Molecular FormulaC13H18O4
Molecular Weight238.28 g/mol
Exact Mass238.12
IUPAC Namedimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
SMILESCOC(=O)C1(C)C2C=CC(C2)C1(C)C(=O)OC
InChIInChI=1S/C13H18O4/c1-12(10(14)16-3)8-5-6-9(7-8)13(12,2)11(15)17-4/h5-6,8-9H,7H2,1-4H3
InChIKeyYADDCRBBADSPJJ-UHFFFAOYSA-N
XLogP1.55
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.28
LogP ≤ 51.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The IUPAC name of dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (CID 13003701) is dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The canonical SMILES for dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is COC(=O)C1(C)C2C=CC(C2)C1(C)C(=O)OC.
What is the InChIKey of dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The InChIKey is YADDCRBBADSPJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-12(10(14)16-3)8-5-6-9(7-8)13(12,2)11(15)17-4/h5-6,8-9H,7H2,1-4H3.
What are the key properties of dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate has a molecular weight of 238.28 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2,3-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is sourced from PubChem (CID 13003701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).