C9H10O3 — CID 130037158
2,9-dioxatricyclo[5.3.1.04,11]undec-7-en-6-one (PubChem CID 130037158) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2,9-dioxatricyclo[5.3.1.04,11]undec-7-en-6-one.
| Compound Name | 2,9-dioxatricyclo[5.3.1.04,11]undec-7-en-6-one |
|---|---|
| PubChem CID | 130037158 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2,9-dioxatricyclo[5.3.1.04,11]undec-7-en-6-one |
| SMILES | O=C1CC2COC3COC=C1C23 |
| InChI | InChI=1S/C9H10O3/c10-7-1-5-2-12-8-4-11-3-6(7)9(5)8/h3,5,8-9H,1-2,4H2 |
| InChIKey | FIEFZHOOJYPVCN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |