About 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile
9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile (PubChem CID 130037436) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile.
Molecular Properties
| Compound Name | 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile |
| PubChem CID | 130037436 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile |
| SMILES | N#CC1C2CC3C(C=CC13)C2=O |
| InChI | InChI=1S/C10H9NO/c11-4-9-5-1-2-6-7(5)3-8(9)10(6)12/h1-2,5-9H,3H2 |
| InChIKey | PYVPZXQPBBDGHP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile?
The IUPAC name of 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile (CID 130037436) is 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile.
What is the SMILES notation for 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile?
The canonical SMILES for 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile is N#CC1C2CC3C(C=CC13)C2=O.
What is the InChIKey of 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile?
The InChIKey is PYVPZXQPBBDGHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c11-4-9-5-1-2-6-7(5)3-8(9)10(6)12/h1-2,5-9H,3H2.
What are the key properties of 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile?
9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile has a molecular weight of 159.19 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxotricyclo[4.2.1.03,7]non-4-ene-2-carbonitrile is sourced from PubChem (CID 130037436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).