About 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine
1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine (PubChem CID 13003750) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine |
| PubChem CID | 13003750 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine |
| SMILES | C1=C(N2CCCC2)CCC(N2CCCC2)=C1 |
| InChI | InChI=1S/C14H22N2/c1-2-10-15(9-1)13-5-7-14(8-6-13)16-11-3-4-12-16/h5,7H,1-4,6,8-12H2 |
| InChIKey | XHXGKBKBNXGHTR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine?
The IUPAC name of 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine (CID 13003750) is 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine.
What is the SMILES notation for 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine?
The canonical SMILES for 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine is C1=C(N2CCCC2)CCC(N2CCCC2)=C1.
What is the InChIKey of 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine?
The InChIKey is XHXGKBKBNXGHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2/c1-2-10-15(9-1)13-5-7-14(8-6-13)16-11-3-4-12-16/h5,7H,1-4,6,8-12H2.
What are the key properties of 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine?
1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine has a molecular weight of 218.34 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)pyrrolidine is sourced from PubChem (CID 13003750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).