About 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one
3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 130037951) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one.
Analyze 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one?
The IUPAC name of 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one (CID 130037951) is 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one.
What is the SMILES notation for 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one?
The canonical SMILES for 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one is CC(C)=C=CC1C(=O)C2CCC1C2.
What is the InChIKey of 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one?
The InChIKey is CWMAEPMYLAMZPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-8(2)3-6-11-9-4-5-10(7-9)12(11)13/h6,9-11H,4-5,7H2,1-2H3.
What are the key properties of 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one?
3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one has a molecular weight of 176.26 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylbuta-1,2-dienyl)bicyclo[2.2.1]heptan-2-one is sourced from PubChem (CID 130037951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).