About methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate
methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 130038537) has the molecular formula C9H7BrN2O2
and a molecular weight of 255.07 g/mol. Its IUPAC name is methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate |
| PubChem CID | 130038537 |
| Molecular Formula | C9H7BrN2O2 |
| Molecular Weight | 255.07 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc2c(Br)cccn12 |
| InChI | InChI=1S/C9H7BrN2O2/c1-14-9(13)7-5-11-8-6(10)3-2-4-12(7)8/h2-5H,1H3 |
| InChIKey | HABCACFGQHBGPE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.07 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate?
The IUPAC name of methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate (CID 130038537) is methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate.
What is the SMILES notation for methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate?
The canonical SMILES for methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate is COC(=O)c1cnc2c(Br)cccn12.
What is the InChIKey of methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate?
The InChIKey is HABCACFGQHBGPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2O2/c1-14-9(13)7-5-11-8-6(10)3-2-4-12(7)8/h2-5H,1H3.
What are the key properties of methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate?
methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate has a molecular weight of 255.07 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-bromoimidazo[1,2-a]pyridine-3-carboxylate is sourced from PubChem (CID 130038537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).