About 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide
7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide (PubChem CID 130038915) has the molecular formula C10H8BrNO2
and a molecular weight of 254.08 g/mol. Its IUPAC name is 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide.
Molecular Properties
| Compound Name | 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide |
| PubChem CID | 130038915 |
| Molecular Formula | C10H8BrNO2 |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide |
| SMILES | NC(=O)c1cc(Br)c2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C10H8BrNO2/c11-8-4-5(10(12)14)3-7-6(8)1-2-9(7)13/h3-4H,1-2H2,(H2,12,14) |
| InChIKey | SHYBBEWXHSWZGY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide?
The IUPAC name of 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide (CID 130038915) is 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide.
What is the SMILES notation for 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide?
The canonical SMILES for 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide is NC(=O)c1cc(Br)c2c(c1)C(=O)CC2.
What is the InChIKey of 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide?
The InChIKey is SHYBBEWXHSWZGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrNO2/c11-8-4-5(10(12)14)3-7-6(8)1-2-9(7)13/h3-4H,1-2H2,(H2,12,14).
What are the key properties of 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide?
7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide has a molecular weight of 254.08 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-oxo-1,2-dihydroindene-5-carboxamide is sourced from PubChem (CID 130038915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).