About 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one
7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one (PubChem CID 130038975) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one |
| PubChem CID | 130038975 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one |
| SMILES | O=C1CCNc2cc(CO)ccc21 |
| InChI | InChI=1S/C10H11NO2/c12-6-7-1-2-8-9(5-7)11-4-3-10(8)13/h1-2,5,11-12H,3-4,6H2 |
| InChIKey | VMHSBHLVYJWRHZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one?
The IUPAC name of 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one (CID 130038975) is 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one.
What is the SMILES notation for 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one?
The canonical SMILES for 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one is O=C1CCNc2cc(CO)ccc21.
What is the InChIKey of 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one?
The InChIKey is VMHSBHLVYJWRHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c12-6-7-1-2-8-9(5-7)11-4-3-10(8)13/h1-2,5,11-12H,3-4,6H2.
What are the key properties of 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one?
7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one has a molecular weight of 177.20 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(hydroxymethyl)-2,3-dihydro-1H-quinolin-4-one is sourced from PubChem (CID 130038975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).