About 8-bromo-3-methoxy-2,3-dihydrochromen-4-one
8-bromo-3-methoxy-2,3-dihydrochromen-4-one (PubChem CID 130039350) has the molecular formula C10H9BrO3
and a molecular weight of 257.08 g/mol. Its IUPAC name is 8-bromo-3-methoxy-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 8-bromo-3-methoxy-2,3-dihydrochromen-4-one |
| PubChem CID | 130039350 |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 8-bromo-3-methoxy-2,3-dihydrochromen-4-one |
| SMILES | COC1COc2c(Br)cccc2C1=O |
| InChI | InChI=1S/C10H9BrO3/c1-13-8-5-14-10-6(9(8)12)3-2-4-7(10)11/h2-4,8H,5H2,1H3 |
| InChIKey | SAASHUFKQJVMEY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-3-methoxy-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3-methoxy-2,3-dihydrochromen-4-one?
The IUPAC name of 8-bromo-3-methoxy-2,3-dihydrochromen-4-one (CID 130039350) is 8-bromo-3-methoxy-2,3-dihydrochromen-4-one.
What is the SMILES notation for 8-bromo-3-methoxy-2,3-dihydrochromen-4-one?
The canonical SMILES for 8-bromo-3-methoxy-2,3-dihydrochromen-4-one is COC1COc2c(Br)cccc2C1=O.
What is the InChIKey of 8-bromo-3-methoxy-2,3-dihydrochromen-4-one?
The InChIKey is SAASHUFKQJVMEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO3/c1-13-8-5-14-10-6(9(8)12)3-2-4-7(10)11/h2-4,8H,5H2,1H3.
What are the key properties of 8-bromo-3-methoxy-2,3-dihydrochromen-4-one?
8-bromo-3-methoxy-2,3-dihydrochromen-4-one has a molecular weight of 257.08 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3-methoxy-2,3-dihydrochromen-4-one is sourced from PubChem (CID 130039350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).