About 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one
3-amino-7-propan-2-yl-2,3-dihydroinden-1-one (PubChem CID 130040004) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one |
| PubChem CID | 130040004 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one |
| SMILES | CC(C)c1cccc2c1C(=O)CC2N |
| InChI | InChI=1S/C12H15NO/c1-7(2)8-4-3-5-9-10(13)6-11(14)12(8)9/h3-5,7,10H,6,13H2,1-2H3 |
| InChIKey | DDLYXNJDPWGBKR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one?
The IUPAC name of 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one (CID 130040004) is 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one.
What is the SMILES notation for 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one?
The canonical SMILES for 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one is CC(C)c1cccc2c1C(=O)CC2N.
What is the InChIKey of 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one?
The InChIKey is DDLYXNJDPWGBKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-7(2)8-4-3-5-9-10(13)6-11(14)12(8)9/h3-5,7,10H,6,13H2,1-2H3.
What are the key properties of 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one?
3-amino-7-propan-2-yl-2,3-dihydroinden-1-one has a molecular weight of 189.26 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-7-propan-2-yl-2,3-dihydroinden-1-one is sourced from PubChem (CID 130040004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).