About 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one
4,7-diamino-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 130040403) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 130040403 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | Nc1ccc2c(c1)C(=O)CCC2N |
| InChI | InChI=1S/C10H12N2O/c11-6-1-2-7-8(5-6)10(13)4-3-9(7)12/h1-2,5,9H,3-4,11-12H2 |
| InChIKey | CFDDQWAPIWWZDO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one (CID 130040403) is 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one is Nc1ccc2c(c1)C(=O)CCC2N.
What is the InChIKey of 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is CFDDQWAPIWWZDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c11-6-1-2-7-8(5-6)10(13)4-3-9(7)12/h1-2,5,9H,3-4,11-12H2.
What are the key properties of 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one?
4,7-diamino-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 176.22 g/mol, XLogP of 1.25, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-diamino-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 130040403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).