C11H17ClN2 — CID 130042351
5-(1-amino-2,2-dimethylpropyl)-2-chloroaniline (PubChem CID 130042351) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 5-(1-amino-2,2-dimethylpropyl)-2-chloroaniline.
| Compound Name | 5-(1-amino-2,2-dimethylpropyl)-2-chloroaniline |
|---|---|
| PubChem CID | 130042351 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5-(1-amino-2,2-dimethylpropyl)-2-chloroaniline |
| SMILES | CC(C)(C)C(N)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C11H17ClN2/c1-11(2,3)10(14)7-4-5-8(12)9(13)6-7/h4-6,10H,13-14H2,1-3H3 |
| InChIKey | MDMORFIJKXRYMS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|