C11H14N2O — CID 130044186
5-amino-5,6,7,8-tetrahydronaphthalene-1-carboxamide (PubChem CID 130044186) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-amino-5,6,7,8-tetrahydronaphthalene-1-carboxamide.
| Compound Name | 5-amino-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 130044186 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-amino-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
| SMILES | NC(=O)c1cccc2c1CCCC2N |
| InChI | InChI=1S/C11H14N2O/c12-10-6-2-3-7-8(10)4-1-5-9(7)11(13)14/h1,4-5,10H,2-3,6,12H2,(H2,13,14) |
| InChIKey | HHMJQLPMNXPXFC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |