About (3-amino-2,3-dihydro-1H-inden-5-yl)methanol
(3-amino-2,3-dihydro-1H-inden-5-yl)methanol (PubChem CID 130044190) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is (3-amino-2,3-dihydro-1H-inden-5-yl)methanol.
Molecular Properties
| Compound Name | (3-amino-2,3-dihydro-1H-inden-5-yl)methanol |
| PubChem CID | 130044190 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (3-amino-2,3-dihydro-1H-inden-5-yl)methanol |
| SMILES | NC1CCc2ccc(CO)cc21 |
| InChI | InChI=1S/C10H13NO/c11-10-4-3-8-2-1-7(6-12)5-9(8)10/h1-2,5,10,12H,3-4,6,11H2 |
| InChIKey | GWXPVNKPNJIKTA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-amino-2,3-dihydro-1H-inden-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-2,3-dihydro-1H-inden-5-yl)methanol?
The IUPAC name of (3-amino-2,3-dihydro-1H-inden-5-yl)methanol (CID 130044190) is (3-amino-2,3-dihydro-1H-inden-5-yl)methanol.
What is the SMILES notation for (3-amino-2,3-dihydro-1H-inden-5-yl)methanol?
The canonical SMILES for (3-amino-2,3-dihydro-1H-inden-5-yl)methanol is NC1CCc2ccc(CO)cc21.
What is the InChIKey of (3-amino-2,3-dihydro-1H-inden-5-yl)methanol?
The InChIKey is GWXPVNKPNJIKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c11-10-4-3-8-2-1-7(6-12)5-9(8)10/h1-2,5,10,12H,3-4,6,11H2.
What are the key properties of (3-amino-2,3-dihydro-1H-inden-5-yl)methanol?
(3-amino-2,3-dihydro-1H-inden-5-yl)methanol has a molecular weight of 163.22 g/mol, XLogP of 1.12, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2,3-dihydro-1H-inden-5-yl)methanol is sourced from PubChem (CID 130044190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).