About 5-amino-2,3-dihydro-1H-quinolin-4-one
5-amino-2,3-dihydro-1H-quinolin-4-one (PubChem CID 130045561) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 5-amino-2,3-dihydro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 5-amino-2,3-dihydro-1H-quinolin-4-one |
| PubChem CID | 130045561 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 5-amino-2,3-dihydro-1H-quinolin-4-one |
| SMILES | Nc1cccc2c1C(=O)CCN2 |
| InChI | InChI=1S/C9H10N2O/c10-6-2-1-3-7-9(6)8(12)4-5-11-7/h1-3,11H,4-5,10H2 |
| InChIKey | ZOJKUKGSBWSGRH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,3-dihydro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,3-dihydro-1H-quinolin-4-one?
The IUPAC name of 5-amino-2,3-dihydro-1H-quinolin-4-one (CID 130045561) is 5-amino-2,3-dihydro-1H-quinolin-4-one.
What is the SMILES notation for 5-amino-2,3-dihydro-1H-quinolin-4-one?
The canonical SMILES for 5-amino-2,3-dihydro-1H-quinolin-4-one is Nc1cccc2c1C(=O)CCN2.
What is the InChIKey of 5-amino-2,3-dihydro-1H-quinolin-4-one?
The InChIKey is ZOJKUKGSBWSGRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c10-6-2-1-3-7-9(6)8(12)4-5-11-7/h1-3,11H,4-5,10H2.
What are the key properties of 5-amino-2,3-dihydro-1H-quinolin-4-one?
5-amino-2,3-dihydro-1H-quinolin-4-one has a molecular weight of 162.19 g/mol, XLogP of 1.27, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,3-dihydro-1H-quinolin-4-one is sourced from PubChem (CID 130045561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).