C9H12N2 — CID 130045562
2-methyl-2,3-dihydro-1H-indol-4-amine (PubChem CID 130045562) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1H-indol-4-amine.
| Compound Name | 2-methyl-2,3-dihydro-1H-indol-4-amine |
|---|---|
| PubChem CID | 130045562 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-methyl-2,3-dihydro-1H-indol-4-amine |
| SMILES | CC1Cc2c(N)cccc2N1 |
| InChI | InChI=1S/C9H12N2/c1-6-5-7-8(10)3-2-4-9(7)11-6/h2-4,6,11H,5,10H2,1H3 |
| InChIKey | DURBGPIUTSQBEF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|