About thieno[2,3-c]pyridin-7-ylmethanol
thieno[2,3-c]pyridin-7-ylmethanol (PubChem CID 130047251) has the molecular formula C8H7NOS
and a molecular weight of 165.22 g/mol. Its IUPAC name is thieno[2,3-c]pyridin-7-ylmethanol.
Molecular Properties
| Compound Name | thieno[2,3-c]pyridin-7-ylmethanol |
| PubChem CID | 130047251 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | thieno[2,3-c]pyridin-7-ylmethanol |
| SMILES | OCc1nccc2ccsc12 |
| InChI | InChI=1S/C8H7NOS/c10-5-7-8-6(1-3-9-7)2-4-11-8/h1-4,10H,5H2 |
| InChIKey | LSSILSMZOYZBLX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[2,3-c]pyridin-7-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-c]pyridin-7-ylmethanol?
The IUPAC name of thieno[2,3-c]pyridin-7-ylmethanol (CID 130047251) is thieno[2,3-c]pyridin-7-ylmethanol.
What is the SMILES notation for thieno[2,3-c]pyridin-7-ylmethanol?
The canonical SMILES for thieno[2,3-c]pyridin-7-ylmethanol is OCc1nccc2ccsc12.
What is the InChIKey of thieno[2,3-c]pyridin-7-ylmethanol?
The InChIKey is LSSILSMZOYZBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NOS/c10-5-7-8-6(1-3-9-7)2-4-11-8/h1-4,10H,5H2.
What are the key properties of thieno[2,3-c]pyridin-7-ylmethanol?
thieno[2,3-c]pyridin-7-ylmethanol has a molecular weight of 165.22 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-c]pyridin-7-ylmethanol is sourced from PubChem (CID 130047251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).