About 4-chloro-2,7-dimethylthieno[3,2-c]pyridine
4-chloro-2,7-dimethylthieno[3,2-c]pyridine (PubChem CID 130047480) has the molecular formula C9H8ClNS
and a molecular weight of 197.69 g/mol. Its IUPAC name is 4-chloro-2,7-dimethylthieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-chloro-2,7-dimethylthieno[3,2-c]pyridine |
| PubChem CID | 130047480 |
| Molecular Formula | C9H8ClNS |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 4-chloro-2,7-dimethylthieno[3,2-c]pyridine |
| SMILES | Cc1cc2c(Cl)ncc(C)c2s1 |
| InChI | InChI=1S/C9H8ClNS/c1-5-4-11-9(10)7-3-6(2)12-8(5)7/h3-4H,1-2H3 |
| InChIKey | WCXHHPALPADBJK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,7-dimethylthieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,7-dimethylthieno[3,2-c]pyridine?
The IUPAC name of 4-chloro-2,7-dimethylthieno[3,2-c]pyridine (CID 130047480) is 4-chloro-2,7-dimethylthieno[3,2-c]pyridine.
What is the SMILES notation for 4-chloro-2,7-dimethylthieno[3,2-c]pyridine?
The canonical SMILES for 4-chloro-2,7-dimethylthieno[3,2-c]pyridine is Cc1cc2c(Cl)ncc(C)c2s1.
What is the InChIKey of 4-chloro-2,7-dimethylthieno[3,2-c]pyridine?
The InChIKey is WCXHHPALPADBJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNS/c1-5-4-11-9(10)7-3-6(2)12-8(5)7/h3-4H,1-2H3.
What are the key properties of 4-chloro-2,7-dimethylthieno[3,2-c]pyridine?
4-chloro-2,7-dimethylthieno[3,2-c]pyridine has a molecular weight of 197.69 g/mol, XLogP of 3.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,7-dimethylthieno[3,2-c]pyridine is sourced from PubChem (CID 130047480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).