C9H8ClNS — CID 130047480
4-chloro-2,7-dimethylthieno[3,2-c]pyridine (PubChem CID 130047480) has the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. Its IUPAC name is 4-chloro-2,7-dimethylthieno[3,2-c]pyridine.
| Compound Name | 4-chloro-2,7-dimethylthieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 130047480 |
| Molecular Formula | C9H8ClNS |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 4-chloro-2,7-dimethylthieno[3,2-c]pyridine |
| SMILES | Cc1cc2c(Cl)ncc(C)c2s1 |
| InChI | InChI=1S/C9H8ClNS/c1-5-4-11-9(10)7-3-6(2)12-8(5)7/h3-4H,1-2H3 |
| InChIKey | WCXHHPALPADBJK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|