About 2-butyl-2-methyl-1,3-oxathiolane
2-butyl-2-methyl-1,3-oxathiolane (PubChem CID 13004868) has the molecular formula C8H16OS
and a molecular weight of 160.28 g/mol. Its IUPAC name is 2-butyl-2-methyl-1,3-oxathiolane.
Molecular Properties
| Compound Name | 2-butyl-2-methyl-1,3-oxathiolane |
| PubChem CID | 13004868 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 2-butyl-2-methyl-1,3-oxathiolane |
| SMILES | CCCCC1(C)OCCS1 |
| InChI | InChI=1S/C8H16OS/c1-3-4-5-8(2)9-6-7-10-8/h3-7H2,1-2H3 |
| InChIKey | ICMGYDYBCRBIRC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-2-methyl-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-2-methyl-1,3-oxathiolane?
The IUPAC name of 2-butyl-2-methyl-1,3-oxathiolane (CID 13004868) is 2-butyl-2-methyl-1,3-oxathiolane.
What is the SMILES notation for 2-butyl-2-methyl-1,3-oxathiolane?
The canonical SMILES for 2-butyl-2-methyl-1,3-oxathiolane is CCCCC1(C)OCCS1.
What is the InChIKey of 2-butyl-2-methyl-1,3-oxathiolane?
The InChIKey is ICMGYDYBCRBIRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OS/c1-3-4-5-8(2)9-6-7-10-8/h3-7H2,1-2H3.
What are the key properties of 2-butyl-2-methyl-1,3-oxathiolane?
2-butyl-2-methyl-1,3-oxathiolane has a molecular weight of 160.28 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-2-methyl-1,3-oxathiolane is sourced from PubChem (CID 13004868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).