About 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile
8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile (PubChem CID 130050504) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile.
Molecular Properties
| Compound Name | 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile |
| PubChem CID | 130050504 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile |
| SMILES | Cc1c(C#N)ccc2c1NCCC2=O |
| InChI | InChI=1S/C11H10N2O/c1-7-8(6-12)2-3-9-10(14)4-5-13-11(7)9/h2-3,13H,4-5H2,1H3 |
| InChIKey | UELSYNSIZYBUPP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile?
The IUPAC name of 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile (CID 130050504) is 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile.
What is the SMILES notation for 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile?
The canonical SMILES for 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile is Cc1c(C#N)ccc2c1NCCC2=O.
What is the InChIKey of 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile?
The InChIKey is UELSYNSIZYBUPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c1-7-8(6-12)2-3-9-10(14)4-5-13-11(7)9/h2-3,13H,4-5H2,1H3.
What are the key properties of 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile?
8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile has a molecular weight of 186.21 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4-oxo-2,3-dihydro-1H-quinoline-7-carbonitrile is sourced from PubChem (CID 130050504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).