C10H10N2O3 — CID 13005093
2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 13005093) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 13005093 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | NC(=O)c1cc2c([nH]c1=O)CCCC2=O |
| InChI | InChI=1S/C10H10N2O3/c11-9(14)6-4-5-7(12-10(6)15)2-1-3-8(5)13/h4H,1-3H2,(H2,11,14)(H,12,15) |
| InChIKey | CBYCFZZAGFYEDF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |