C8H8BrN3S — CID 130051359
7-bromo-2-ethylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 130051359) has the molecular formula C8H8BrN3S and a molecular weight of 258.14 g/mol. Its IUPAC name is 7-bromo-2-ethylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 7-bromo-2-ethylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 130051359 |
| Molecular Formula | C8H8BrN3S |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 256.96 |
| IUPAC Name | 7-bromo-2-ethylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCc1nc(N)c2scc(Br)c2n1 |
| InChI | InChI=1S/C8H8BrN3S/c1-2-5-11-6-4(9)3-13-7(6)8(10)12-5/h3H,2H2,1H3,(H2,10,11,12) |
| InChIKey | CJMCUYSPEASDGM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |