C9H4Cl2OS — CID 130051374
7,8-dichlorothiochromen-4-one (PubChem CID 130051374) has the molecular formula C9H4Cl2OS and a molecular weight of 231.10 g/mol. Its IUPAC name is 7,8-dichlorothiochromen-4-one.
| Compound Name | 7,8-dichlorothiochromen-4-one |
|---|---|
| PubChem CID | 130051374 |
| Molecular Formula | C9H4Cl2OS |
| Molecular Weight | 231.10 g/mol |
| Exact Mass | 229.94 |
| IUPAC Name | 7,8-dichlorothiochromen-4-one |
| SMILES | O=c1ccsc2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C9H4Cl2OS/c10-6-2-1-5-7(12)3-4-13-9(5)8(6)11/h1-4H |
| InChIKey | LDNGXLCRGUKEQC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |