About methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate
methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate (PubChem CID 1300533) has the molecular formula C24H19N3O5
and a molecular weight of 429.43 g/mol. Its IUPAC name is methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate.
Molecular Properties
| Compound Name | methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate |
| PubChem CID | 1300533 |
| Molecular Formula | C24H19N3O5 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc3c(c2)C(=O)N(Cc2cccnc2)C3=O)c1C |
| InChI | InChI=1S/C24H19N3O5/c1-14-17(24(31)32-2)6-3-7-20(14)26-21(28)16-8-9-18-19(11-16)23(30)27(22(18)29)13-15-5-4-10-25-12-15/h3-12H,13H2,1-2H3,(H,26,28) |
| InChIKey | UBZDBWHZIHRHLO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate?
The IUPAC name of methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate (CID 1300533) is methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate.
What is the SMILES notation for methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate?
The canonical SMILES for methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate is COC(=O)c1cccc(NC(=O)c2ccc3c(c2)C(=O)N(Cc2cccnc2)C3=O)c1C.
What is the InChIKey of methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate?
The InChIKey is UBZDBWHZIHRHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N3O5/c1-14-17(24(31)32-2)6-3-7-20(14)26-21(28)16-8-9-18-19(11-16)23(30)27(22(18)29)13-15-5-4-10-25-12-15/h3-12H,13H2,1-2H3,(H,26,28).
What are the key properties of methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate?
methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate has a molecular weight of 429.43 g/mol, XLogP of 3.23, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]-2-methylbenzoate is sourced from PubChem (CID 1300533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).