C9H9ClN2 — CID 130053419
3-chloro-5,6-dimethyl-2H-indazole (PubChem CID 130053419) has the molecular formula C9H9ClN2 and a molecular weight of 180.64 g/mol. Its IUPAC name is 3-chloro-5,6-dimethyl-2H-indazole.
| Compound Name | 3-chloro-5,6-dimethyl-2H-indazole |
|---|---|
| PubChem CID | 130053419 |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 3-chloro-5,6-dimethyl-2H-indazole |
| SMILES | Cc1cc2n[nH]c(Cl)c2cc1C |
| InChI | InChI=1S/C9H9ClN2/c1-5-3-7-8(4-6(5)2)11-12-9(7)10/h3-4H,1-2H3,(H,11,12) |
| InChIKey | SAKOCRSJJHPSAF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |