C14H20BNO5S — CID 130053516
N-[2-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide (PubChem CID 130053516) has the molecular formula C14H20BNO5S and a molecular weight of 325.20 g/mol. Its IUPAC name is N-[2-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide.
| Compound Name | N-[2-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 130053516 |
| Molecular Formula | C14H20BNO5S |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[2-formyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
| SMILES | CC1(C)OB(c2cccc(NS(C)(=O)=O)c2C=O)OC1(C)C |
| InChI | InChI=1S/C14H20BNO5S/c1-13(2)14(3,4)21-15(20-13)11-7-6-8-12(10(11)9-17)16-22(5,18)19/h6-9,16H,1-5H3 |
| InChIKey | ZVNQDUXDWTWEIM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|