C9H13BN2O4 — CID 130053665
[1-(5,8-dioxaspiro[3.4]octan-2-yl)pyrazol-4-yl]boronic acid (PubChem CID 130053665) has the molecular formula C9H13BN2O4 and a molecular weight of 224.02 g/mol. Its IUPAC name is [1-(5,8-dioxaspiro[3.4]octan-2-yl)pyrazol-4-yl]boronic acid.
| Compound Name | [1-(5,8-dioxaspiro[3.4]octan-2-yl)pyrazol-4-yl]boronic acid |
|---|---|
| PubChem CID | 130053665 |
| Molecular Formula | C9H13BN2O4 |
| Molecular Weight | 224.02 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [1-(5,8-dioxaspiro[3.4]octan-2-yl)pyrazol-4-yl]boronic acid |
| SMILES | OB(O)c1cnn(C2CC3(C2)OCCO3)c1 |
| InChI | InChI=1S/C9H13BN2O4/c13-10(14)7-5-11-12(6-7)8-3-9(4-8)15-1-2-16-9/h5-6,8,13-14H,1-4H2 |
| InChIKey | ZNFQJTIPSHHGBP-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.02 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|