About 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine
7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 130054307) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine |
| PubChem CID | 130054307 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCOc1ccc(C)c2c1OCC2N |
| InChI | InChI=1S/C11H15NO2/c1-3-13-9-5-4-7(2)10-8(12)6-14-11(9)10/h4-5,8H,3,6,12H2,1-2H3 |
| InChIKey | PWBYUKSUVJRGCN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine?
The IUPAC name of 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine (CID 130054307) is 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine.
What is the SMILES notation for 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine?
The canonical SMILES for 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine is CCOc1ccc(C)c2c1OCC2N.
What is the InChIKey of 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine?
The InChIKey is PWBYUKSUVJRGCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-3-13-9-5-4-7(2)10-8(12)6-14-11(9)10/h4-5,8H,3,6,12H2,1-2H3.
What are the key properties of 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine?
7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine has a molecular weight of 193.25 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-4-methyl-2,3-dihydro-1-benzofuran-3-amine is sourced from PubChem (CID 130054307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).