About 2-ethynyl-1,3-oxazol-5-amine
2-ethynyl-1,3-oxazol-5-amine (PubChem CID 130055354) has the molecular formula C5H4N2O
and a molecular weight of 108.10 g/mol. Its IUPAC name is 2-ethynyl-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | 2-ethynyl-1,3-oxazol-5-amine |
| PubChem CID | 130055354 |
| Molecular Formula | C5H4N2O |
| Molecular Weight | 108.10 g/mol |
| Exact Mass | 108.03 |
| IUPAC Name | 2-ethynyl-1,3-oxazol-5-amine |
| SMILES | C#Cc1ncc(N)o1 |
| InChI | InChI=1S/C5H4N2O/c1-2-5-7-3-4(6)8-5/h1,3H,6H2 |
| InChIKey | BOYZHDYNHLQNSJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.10 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-1,3-oxazol-5-amine?
The IUPAC name of 2-ethynyl-1,3-oxazol-5-amine (CID 130055354) is 2-ethynyl-1,3-oxazol-5-amine.
What is the SMILES notation for 2-ethynyl-1,3-oxazol-5-amine?
The canonical SMILES for 2-ethynyl-1,3-oxazol-5-amine is C#Cc1ncc(N)o1.
What is the InChIKey of 2-ethynyl-1,3-oxazol-5-amine?
The InChIKey is BOYZHDYNHLQNSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O/c1-2-5-7-3-4(6)8-5/h1,3H,6H2.
What are the key properties of 2-ethynyl-1,3-oxazol-5-amine?
2-ethynyl-1,3-oxazol-5-amine has a molecular weight of 108.10 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-1,3-oxazol-5-amine is sourced from PubChem (CID 130055354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).