About 4-formyl-1,3-thiazole-2-carbonitrile
4-formyl-1,3-thiazole-2-carbonitrile (PubChem CID 130056331) has the molecular formula C5H2N2OS
and a molecular weight of 138.15 g/mol. Its IUPAC name is 4-formyl-1,3-thiazole-2-carbonitrile.
Molecular Properties
| Compound Name | 4-formyl-1,3-thiazole-2-carbonitrile |
| PubChem CID | 130056331 |
| Molecular Formula | C5H2N2OS |
| Molecular Weight | 138.15 g/mol |
| Exact Mass | 137.99 |
| IUPAC Name | 4-formyl-1,3-thiazole-2-carbonitrile |
| SMILES | N#Cc1nc(C=O)cs1 |
| InChI | InChI=1S/C5H2N2OS/c6-1-5-7-4(2-8)3-9-5/h2-3H |
| InChIKey | YEAYRHLLYRWIEG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formyl-1,3-thiazole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formyl-1,3-thiazole-2-carbonitrile?
The IUPAC name of 4-formyl-1,3-thiazole-2-carbonitrile (CID 130056331) is 4-formyl-1,3-thiazole-2-carbonitrile.
What is the SMILES notation for 4-formyl-1,3-thiazole-2-carbonitrile?
The canonical SMILES for 4-formyl-1,3-thiazole-2-carbonitrile is N#Cc1nc(C=O)cs1.
What is the InChIKey of 4-formyl-1,3-thiazole-2-carbonitrile?
The InChIKey is YEAYRHLLYRWIEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2N2OS/c6-1-5-7-4(2-8)3-9-5/h2-3H.
What are the key properties of 4-formyl-1,3-thiazole-2-carbonitrile?
4-formyl-1,3-thiazole-2-carbonitrile has a molecular weight of 138.15 g/mol, XLogP of 0.83, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formyl-1,3-thiazole-2-carbonitrile is sourced from PubChem (CID 130056331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).