About 5-acetylfuro[2,3-c]pyridine-7-carbonitrile
5-acetylfuro[2,3-c]pyridine-7-carbonitrile (PubChem CID 130056722) has the molecular formula C10H6N2O2
and a molecular weight of 186.17 g/mol. Its IUPAC name is 5-acetylfuro[2,3-c]pyridine-7-carbonitrile.
Molecular Properties
| Compound Name | 5-acetylfuro[2,3-c]pyridine-7-carbonitrile |
| PubChem CID | 130056722 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 5-acetylfuro[2,3-c]pyridine-7-carbonitrile |
| SMILES | CC(=O)c1cc2ccoc2c(C#N)n1 |
| InChI | InChI=1S/C10H6N2O2/c1-6(13)8-4-7-2-3-14-10(7)9(5-11)12-8/h2-4H,1H3 |
| InChIKey | BDJJAYDQFDIKGJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-acetylfuro[2,3-c]pyridine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetylfuro[2,3-c]pyridine-7-carbonitrile?
The IUPAC name of 5-acetylfuro[2,3-c]pyridine-7-carbonitrile (CID 130056722) is 5-acetylfuro[2,3-c]pyridine-7-carbonitrile.
What is the SMILES notation for 5-acetylfuro[2,3-c]pyridine-7-carbonitrile?
The canonical SMILES for 5-acetylfuro[2,3-c]pyridine-7-carbonitrile is CC(=O)c1cc2ccoc2c(C#N)n1.
What is the InChIKey of 5-acetylfuro[2,3-c]pyridine-7-carbonitrile?
The InChIKey is BDJJAYDQFDIKGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2/c1-6(13)8-4-7-2-3-14-10(7)9(5-11)12-8/h2-4H,1H3.
What are the key properties of 5-acetylfuro[2,3-c]pyridine-7-carbonitrile?
5-acetylfuro[2,3-c]pyridine-7-carbonitrile has a molecular weight of 186.17 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetylfuro[2,3-c]pyridine-7-carbonitrile is sourced from PubChem (CID 130056722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).