About 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde
2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde (PubChem CID 130056874) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde |
| PubChem CID | 130056874 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde |
| SMILES | O=Cc1nccc2c1CNC2 |
| InChI | InChI=1S/C8H8N2O/c11-5-8-7-4-9-3-6(7)1-2-10-8/h1-2,5,9H,3-4H2 |
| InChIKey | AKQSLOSKALDGQN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde?
The IUPAC name of 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde (CID 130056874) is 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde.
What is the SMILES notation for 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde?
The canonical SMILES for 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde is O=Cc1nccc2c1CNC2.
What is the InChIKey of 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde?
The InChIKey is AKQSLOSKALDGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-5-8-7-4-9-3-6(7)1-2-10-8/h1-2,5,9H,3-4H2.
What are the key properties of 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde?
2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde has a molecular weight of 148.16 g/mol, XLogP of 0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carbaldehyde is sourced from PubChem (CID 130056874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).