C12H15FO — CID 130057182
1-cyclobutyloxy-2-fluoro-3,5-dimethylbenzene (PubChem CID 130057182) has the molecular formula C12H15FO and a molecular weight of 194.25 g/mol. Its IUPAC name is 1-cyclobutyloxy-2-fluoro-3,5-dimethylbenzene.
| Compound Name | 1-cyclobutyloxy-2-fluoro-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 130057182 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-cyclobutyloxy-2-fluoro-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)c(F)c(OC2CCC2)c1 |
| InChI | InChI=1S/C12H15FO/c1-8-6-9(2)12(13)11(7-8)14-10-4-3-5-10/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | KXALSNCSDMZKCR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |