C6H9N3O — CID 130057572
5,6-diamino-2-methylpyridin-3-ol (PubChem CID 130057572) has the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. Its IUPAC name is 5,6-diamino-2-methylpyridin-3-ol.
| Compound Name | 5,6-diamino-2-methylpyridin-3-ol |
|---|---|
| PubChem CID | 130057572 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 5,6-diamino-2-methylpyridin-3-ol |
| SMILES | Cc1nc(N)c(N)cc1O |
| InChI | InChI=1S/C6H9N3O/c1-3-5(10)2-4(7)6(8)9-3/h2,10H,7H2,1H3,(H2,8,9) |
| InChIKey | LJPDBDHFNCTECT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |