C15H17NO3 — CID 13005865
(1S,9R,12R)-4-hydroxy-13-methyl-8-oxa-13-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-10-one (PubChem CID 13005865) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is (1S,9R,12R)-4-hydroxy-13-methyl-8-oxa-13-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-10-one.
| Compound Name | (1S,9R,12R)-4-hydroxy-13-methyl-8-oxa-13-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-10-one |
|---|---|
| PubChem CID | 13005865 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (1S,9R,12R)-4-hydroxy-13-methyl-8-oxa-13-azatetracyclo[10.3.1.01,9.02,7]hexadeca-2(7),3,5-trien-10-one |
| SMILES | CN1CC[C@@]23C[C@@H]1CC(=O)[C@@H]2Oc1ccc(O)cc13 |
| InChI | InChI=1S/C15H17NO3/c1-16-5-4-15-8-9(16)6-12(18)14(15)19-13-3-2-10(17)7-11(13)15/h2-3,7,9,14,17H,4-6,8H2,1H3/t9-,14-,15-/m0/s1 |
| InChIKey | CCRLAAUJPGXSIB-LNHVQRHZSA-N |
| XLogP | 1.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |