About 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine
1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine (PubChem CID 130059138) has the molecular formula C7H7BrF2N2
and a molecular weight of 237.05 g/mol. Its IUPAC name is 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine |
| PubChem CID | 130059138 |
| Molecular Formula | C7H7BrF2N2 |
| Molecular Weight | 237.05 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine |
| SMILES | NC(c1ccnc(Br)c1)C(F)F |
| InChI | InChI=1S/C7H7BrF2N2/c8-5-3-4(1-2-12-5)6(11)7(9)10/h1-3,6-7H,11H2 |
| InChIKey | FQLAZDQLGZRQTL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.05 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine?
The IUPAC name of 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine (CID 130059138) is 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine.
What is the SMILES notation for 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine?
The canonical SMILES for 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine is NC(c1ccnc(Br)c1)C(F)F.
What is the InChIKey of 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine?
The InChIKey is FQLAZDQLGZRQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrF2N2/c8-5-3-4(1-2-12-5)6(11)7(9)10/h1-3,6-7H,11H2.
What are the key properties of 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine?
1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine has a molecular weight of 237.05 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine is sourced from PubChem (CID 130059138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).