C7H7BrF2N2 — CID 130059138
1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine (PubChem CID 130059138) has the molecular formula C7H7BrF2N2 and a molecular weight of 237.05 g/mol. Its IUPAC name is 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine.
| Compound Name | 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 130059138 |
| Molecular Formula | C7H7BrF2N2 |
| Molecular Weight | 237.05 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 1-(2-bromo-4-pyridinyl)-2,2-difluoroethanamine |
| SMILES | NC(c1ccnc(Br)c1)C(F)F |
| InChI | InChI=1S/C7H7BrF2N2/c8-5-3-4(1-2-12-5)6(11)7(9)10/h1-3,6-7H,11H2 |
| InChIKey | FQLAZDQLGZRQTL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.05 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|