C15H18O3 — CID 13005952
(9aS)-6,6,9a-trimethyl-3,7,8,9-tetrahydrobenzo[g][2]benzofuran-1,4-dione (PubChem CID 13005952) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (9aS)-6,6,9a-trimethyl-3,7,8,9-tetrahydrobenzo[g][2]benzofuran-1,4-dione.
| Compound Name | (9aS)-6,6,9a-trimethyl-3,7,8,9-tetrahydrobenzo[g][2]benzofuran-1,4-dione |
|---|---|
| PubChem CID | 13005952 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (9aS)-6,6,9a-trimethyl-3,7,8,9-tetrahydrobenzo[g][2]benzofuran-1,4-dione |
| SMILES | CC1(C)CCC[C@@]2(C)C1=CC(=O)C1=C2C(=O)OC1 |
| InChI | InChI=1S/C15H18O3/c1-14(2)5-4-6-15(3)11(14)7-10(16)9-8-18-13(17)12(9)15/h7H,4-6,8H2,1-3H3/t15-/m0/s1 |
| InChIKey | RJNTWOQXGPYTEQ-HNNXBMFYSA-N |
| XLogP | 2.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |