About 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid
5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 130061481) has the molecular formula C11H11FO3
and a molecular weight of 210.20 g/mol. Its IUPAC name is 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| PubChem CID | 130061481 |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | Cc1ccc(F)c2c1OCC(C(=O)O)C2 |
| InChI | InChI=1S/C11H11FO3/c1-6-2-3-9(12)8-4-7(11(13)14)5-15-10(6)8/h2-3,7H,4-5H2,1H3,(H,13,14) |
| InChIKey | ODKMOLWYEFJQPO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid?
The IUPAC name of 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CID 130061481) is 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid.
What is the SMILES notation for 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid?
The canonical SMILES for 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid is Cc1ccc(F)c2c1OCC(C(=O)O)C2.
What is the InChIKey of 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid?
The InChIKey is ODKMOLWYEFJQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO3/c1-6-2-3-9(12)8-4-7(11(13)14)5-15-10(6)8/h2-3,7H,4-5H2,1H3,(H,13,14).
What are the key properties of 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid?
5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid has a molecular weight of 210.20 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid is sourced from PubChem (CID 130061481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).