C25H17N5O4S — CID 13006217
3-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-1-methyl-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrole-2,5-dione (PubChem CID 13006217) has the molecular formula C25H17N5O4S and a molecular weight of 483.51 g/mol. Its IUPAC name is 3-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-1-methyl-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-1-methyl-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 13006217 |
| Molecular Formula | C25H17N5O4S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 3-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-1-methyl-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrrole-2,5-dione |
| SMILES | CN1C(=O)C(c2c[nH]c3ncccc23)=C(c2cn(S(=O)(=O)c3ccccc3)c3ncccc23)C1=O |
| InChI | InChI=1S/C25H17N5O4S/c1-29-24(31)20(18-13-28-22-16(18)9-5-11-26-22)21(25(29)32)19-14-30(23-17(19)10-6-12-27-23)35(33,34)15-7-3-2-4-8-15/h2-14H,1H3,(H,26,28) |
| InChIKey | FXPDOKSKWGVOGX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|