C8H6BrF3O — CID 130062648
1-(2-bromo-6-fluorophenyl)-2,2-difluoroethanol (PubChem CID 130062648) has the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. Its IUPAC name is 1-(2-bromo-6-fluorophenyl)-2,2-difluoroethanol.
| Compound Name | 1-(2-bromo-6-fluorophenyl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 130062648 |
| Molecular Formula | C8H6BrF3O |
| Molecular Weight | 255.03 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 1-(2-bromo-6-fluorophenyl)-2,2-difluoroethanol |
| SMILES | OC(c1c(F)cccc1Br)C(F)F |
| InChI | InChI=1S/C8H6BrF3O/c9-4-2-1-3-5(10)6(4)7(13)8(11)12/h1-3,7-8,13H |
| InChIKey | PZYAIBVUNLKOIW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.03 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |