C21H30O4S — CID 13006271
[(1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate (PubChem CID 13006271) has the molecular formula C21H30O4S and a molecular weight of 378.53 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate |
|---|---|
| PubChem CID | 13006271 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC[C@]2(C)[C@@H]([C@H](C)CS(=O)(=O)c3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C21H30O4S/c1-15(14-26(23,24)17-8-5-4-6-9-17)18-11-12-19-20(25-16(2)22)10-7-13-21(18,19)3/h4-6,8-9,15,18-20H,7,10-14H2,1-3H3/t15-,18-,19+,20+,21-/m1/s1 |
| InChIKey | WMZDMZWBDSCIEG-DRYZZIBHSA-N |
| XLogP | 4.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |