C24H38O5S — CID 13006272
(3R,6S)-6-[(1R,3aR,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-(benzenesulfonyl)-2-methylheptane-2,3-diol (PubChem CID 13006272) has the molecular formula C24H38O5S and a molecular weight of 438.63 g/mol. Its IUPAC name is (3R,6S)-6-[(1R,3aR,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-(benzenesulfonyl)-2-methylheptane-2,3-diol.
| Compound Name | (3R,6S)-6-[(1R,3aR,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-(benzenesulfonyl)-2-methylheptane-2,3-diol |
|---|---|
| PubChem CID | 13006272 |
| Molecular Formula | C24H38O5S |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (3R,6S)-6-[(1R,3aR,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-(benzenesulfonyl)-2-methylheptane-2,3-diol |
| SMILES | C[C@H](C(C[C@@H](O)C(C)(C)O)S(=O)(=O)c1ccccc1)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C24H38O5S/c1-16(18-12-13-19-20(25)11-8-14-24(18,19)4)21(15-22(26)23(2,3)27)30(28,29)17-9-6-5-7-10-17/h5-7,9-10,16,18-22,25-27H,8,11-15H2,1-4H3/t16-,18+,19-,20-,21?,22+,24+/m0/s1 |
| InChIKey | KPUPASQXDHGEHO-WKILYPKUSA-N |
| XLogP | 3.56 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |