C10H10FN — CID 130063636
5-fluoro-2,6-dimethyl-1H-indole (PubChem CID 130063636) has the molecular formula C10H10FN and a molecular weight of 163.19 g/mol. Its IUPAC name is 5-fluoro-2,6-dimethyl-1H-indole.
| Compound Name | 5-fluoro-2,6-dimethyl-1H-indole |
|---|---|
| PubChem CID | 130063636 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 5-fluoro-2,6-dimethyl-1H-indole |
| SMILES | Cc1cc2cc(F)c(C)cc2[nH]1 |
| InChI | InChI=1S/C10H10FN/c1-6-3-10-8(5-9(6)11)4-7(2)12-10/h3-5,12H,1-2H3 |
| InChIKey | PDDKZWQPDRUVAY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |