About 4-fluoro-7-methoxy-1,2-benzoxazole
4-fluoro-7-methoxy-1,2-benzoxazole (PubChem CID 130063972) has the molecular formula C8H6FNO2
and a molecular weight of 167.14 g/mol. Its IUPAC name is 4-fluoro-7-methoxy-1,2-benzoxazole.
Molecular Properties
| Compound Name | 4-fluoro-7-methoxy-1,2-benzoxazole |
| PubChem CID | 130063972 |
| Molecular Formula | C8H6FNO2 |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 4-fluoro-7-methoxy-1,2-benzoxazole |
| SMILES | COc1ccc(F)c2cnoc12 |
| InChI | InChI=1S/C8H6FNO2/c1-11-7-3-2-6(9)5-4-10-12-8(5)7/h2-4H,1H3 |
| InChIKey | PMJPNFLZJGZARG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-7-methoxy-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-7-methoxy-1,2-benzoxazole?
The IUPAC name of 4-fluoro-7-methoxy-1,2-benzoxazole (CID 130063972) is 4-fluoro-7-methoxy-1,2-benzoxazole.
What is the SMILES notation for 4-fluoro-7-methoxy-1,2-benzoxazole?
The canonical SMILES for 4-fluoro-7-methoxy-1,2-benzoxazole is COc1ccc(F)c2cnoc12.
What is the InChIKey of 4-fluoro-7-methoxy-1,2-benzoxazole?
The InChIKey is PMJPNFLZJGZARG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FNO2/c1-11-7-3-2-6(9)5-4-10-12-8(5)7/h2-4H,1H3.
What are the key properties of 4-fluoro-7-methoxy-1,2-benzoxazole?
4-fluoro-7-methoxy-1,2-benzoxazole has a molecular weight of 167.14 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-7-methoxy-1,2-benzoxazole is sourced from PubChem (CID 130063972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).