methyl 7-methyl-1,2-benzothiazole-4-carboxylate

C10H9NO2S — CID 130064177

IUPACmethyl 7-methyl-1,2-benzothiazole-4-carboxylate
SMILESCOC(=O)c1ccc(C)c2sncc12
InChIInChI=1S/C10H9NO2S/c1-6-3-4-7(10(12)13-2)8-5-11-14-9(6)8/h3-5H,1-2H3
InChIKeyRVSXREQCXFYLCS-UHFFFAOYSA-N
MW207.25 g/mol
LogP2.39
Rot. Bonds1

About methyl 7-methyl-1,2-benzothiazole-4-carboxylate

methyl 7-methyl-1,2-benzothiazole-4-carboxylate (PubChem CID 130064177) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is methyl 7-methyl-1,2-benzothiazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 7-methyl-1,2-benzothiazole-4-carboxylate
PubChem CID130064177
Molecular FormulaC10H9NO2S
Molecular Weight207.25 g/mol
Exact Mass207.04
IUPAC Namemethyl 7-methyl-1,2-benzothiazole-4-carboxylate
SMILESCOC(=O)c1ccc(C)c2sncc12
InChIInChI=1S/C10H9NO2S/c1-6-3-4-7(10(12)13-2)8-5-11-14-9(6)8/h3-5H,1-2H3
InChIKeyRVSXREQCXFYLCS-UHFFFAOYSA-N
XLogP2.39
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.25
LogP ≤ 52.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 7-methyl-1,2-benzothiazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 7-methyl-1,2-benzothiazole-4-carboxylate?
The IUPAC name of methyl 7-methyl-1,2-benzothiazole-4-carboxylate (CID 130064177) is methyl 7-methyl-1,2-benzothiazole-4-carboxylate.
What is the SMILES notation for methyl 7-methyl-1,2-benzothiazole-4-carboxylate?
The canonical SMILES for methyl 7-methyl-1,2-benzothiazole-4-carboxylate is COC(=O)c1ccc(C)c2sncc12.
What is the InChIKey of methyl 7-methyl-1,2-benzothiazole-4-carboxylate?
The InChIKey is RVSXREQCXFYLCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S/c1-6-3-4-7(10(12)13-2)8-5-11-14-9(6)8/h3-5H,1-2H3.
What are the key properties of methyl 7-methyl-1,2-benzothiazole-4-carboxylate?
methyl 7-methyl-1,2-benzothiazole-4-carboxylate has a molecular weight of 207.25 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-methyl-1,2-benzothiazole-4-carboxylate is sourced from PubChem (CID 130064177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).