C9H10FNO — CID 130064518
6-fluoro-4-methoxy-2,3-dihydro-1H-isoindole (PubChem CID 130064518) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is 6-fluoro-4-methoxy-2,3-dihydro-1H-isoindole.
| Compound Name | 6-fluoro-4-methoxy-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 130064518 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 6-fluoro-4-methoxy-2,3-dihydro-1H-isoindole |
| SMILES | COc1cc(F)cc2c1CNC2 |
| InChI | InChI=1S/C9H10FNO/c1-12-9-3-7(10)2-6-4-11-5-8(6)9/h2-3,11H,4-5H2,1H3 |
| InChIKey | CHMFHDFJYUBGQC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |