About imidazo[1,5-a]pyridine-5,7-dicarbonitrile
imidazo[1,5-a]pyridine-5,7-dicarbonitrile (PubChem CID 130066229) has the molecular formula C9H4N4
and a molecular weight of 168.16 g/mol. Its IUPAC name is imidazo[1,5-a]pyridine-5,7-dicarbonitrile.
Molecular Properties
| Compound Name | imidazo[1,5-a]pyridine-5,7-dicarbonitrile |
| PubChem CID | 130066229 |
| Molecular Formula | C9H4N4 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | imidazo[1,5-a]pyridine-5,7-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)n2cncc2c1 |
| InChI | InChI=1S/C9H4N4/c10-3-7-1-8(4-11)13-6-12-5-9(13)2-7/h1-2,5-6H |
| InChIKey | OBRLEZOUBISDJW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazo[1,5-a]pyridine-5,7-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,5-a]pyridine-5,7-dicarbonitrile?
The IUPAC name of imidazo[1,5-a]pyridine-5,7-dicarbonitrile (CID 130066229) is imidazo[1,5-a]pyridine-5,7-dicarbonitrile.
What is the SMILES notation for imidazo[1,5-a]pyridine-5,7-dicarbonitrile?
The canonical SMILES for imidazo[1,5-a]pyridine-5,7-dicarbonitrile is N#Cc1cc(C#N)n2cncc2c1.
What is the InChIKey of imidazo[1,5-a]pyridine-5,7-dicarbonitrile?
The InChIKey is OBRLEZOUBISDJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N4/c10-3-7-1-8(4-11)13-6-12-5-9(13)2-7/h1-2,5-6H.
What are the key properties of imidazo[1,5-a]pyridine-5,7-dicarbonitrile?
imidazo[1,5-a]pyridine-5,7-dicarbonitrile has a molecular weight of 168.16 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,5-a]pyridine-5,7-dicarbonitrile is sourced from PubChem (CID 130066229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).